C13H12N6 — CID 43826587
5-(5-pyridin-3-yl-1H-1,2,4-triazol-3-yl)benzene-1,3-diamine (PubChem CID 43826587) has the molecular formula C13H12N6 and a molecular weight of 252.28 g/mol. Its IUPAC name is 5-(5-pyridin-3-yl-1H-1,2,4-triazol-3-yl)benzene-1,3-diamine.
| Compound Name | 5-(5-pyridin-3-yl-1H-1,2,4-triazol-3-yl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 43826587 |
| Molecular Formula | C13H12N6 |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 5-(5-pyridin-3-yl-1H-1,2,4-triazol-3-yl)benzene-1,3-diamine |
| SMILES | Nc1cc(N)cc(-c2n[nH]c(-c3cccnc3)n2)c1 |
| InChI | InChI=1S/C13H12N6/c14-10-4-9(5-11(15)6-10)13-17-12(18-19-13)8-2-1-3-16-7-8/h1-7H,14-15H2,(H,17,18,19) |
| InChIKey | FJATUPDQUJVIQV-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|