C11H15N5 — CID 154759721
N,N-diethyl-5-pyridin-3-yl-1H-1,2,4-triazol-3-amine (PubChem CID 154759721) has the molecular formula C11H15N5 and a molecular weight of 217.28 g/mol. Its IUPAC name is N,N-diethyl-5-pyridin-3-yl-1H-1,2,4-triazol-3-amine.
| Compound Name | N,N-diethyl-5-pyridin-3-yl-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 154759721 |
| Molecular Formula | C11H15N5 |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | N,N-diethyl-5-pyridin-3-yl-1H-1,2,4-triazol-3-amine |
| SMILES | CCN(CC)c1n[nH]c(-c2cccnc2)n1 |
| InChI | InChI=1S/C11H15N5/c1-3-16(4-2)11-13-10(14-15-11)9-6-5-7-12-8-9/h5-8H,3-4H2,1-2H3,(H,13,14,15) |
| InChIKey | XOFWCACMJPTGRH-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |