C17H18N4OS — CID 71888166
3-[3-[2-(2,6-dimethylphenoxy)ethylsulfanyl]-1H-1,2,4-triazol-5-yl]pyridine (PubChem CID 71888166) has the molecular formula C17H18N4OS and a molecular weight of 326.43 g/mol. Its IUPAC name is 3-[3-[2-(2,6-dimethylphenoxy)ethylsulfanyl]-1H-1,2,4-triazol-5-yl]pyridine.
| Compound Name | 3-[3-[2-(2,6-dimethylphenoxy)ethylsulfanyl]-1H-1,2,4-triazol-5-yl]pyridine |
|---|---|
| PubChem CID | 71888166 |
| Molecular Formula | C17H18N4OS |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 3-[3-[2-(2,6-dimethylphenoxy)ethylsulfanyl]-1H-1,2,4-triazol-5-yl]pyridine |
| SMILES | Cc1cccc(C)c1OCCSc1n[nH]c(-c2cccnc2)n1 |
| InChI | InChI=1S/C17H18N4OS/c1-12-5-3-6-13(2)15(12)22-9-10-23-17-19-16(20-21-17)14-7-4-8-18-11-14/h3-8,11H,9-10H2,1-2H3,(H,19,20,21) |
| InChIKey | JEQPZOVPTMLMEY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|