C19H20ClN3O2S — CID 112786227
5-(5-chloro-2-methoxyphenyl)-3-[2-(2,6-dimethylphenoxy)ethylsulfanyl]-1H-1,2,4-triazole (PubChem CID 112786227) has the molecular formula C19H20ClN3O2S and a molecular weight of 389.91 g/mol. Its IUPAC name is 5-(5-chloro-2-methoxyphenyl)-3-[2-(2,6-dimethylphenoxy)ethylsulfanyl]-1H-1,2,4-triazole.
| Compound Name | 5-(5-chloro-2-methoxyphenyl)-3-[2-(2,6-dimethylphenoxy)ethylsulfanyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 112786227 |
| Molecular Formula | C19H20ClN3O2S |
| Molecular Weight | 389.91 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 5-(5-chloro-2-methoxyphenyl)-3-[2-(2,6-dimethylphenoxy)ethylsulfanyl]-1H-1,2,4-triazole |
| SMILES | COc1ccc(Cl)cc1-c1nc(SCCOc2c(C)cccc2C)n[nH]1 |
| InChI | InChI=1S/C19H20ClN3O2S/c1-12-5-4-6-13(2)17(12)25-9-10-26-19-21-18(22-23-19)15-11-14(20)7-8-16(15)24-3/h4-8,11H,9-10H2,1-3H3,(H,21,22,23) |
| InChIKey | HATRMLUOEWVHTM-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.91 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|