C19H18ClN3O2S — CID 16543370
4-[[5-(5-chloro-2-methoxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-1-phenylbutan-1-one (PubChem CID 16543370) has the molecular formula C19H18ClN3O2S and a molecular weight of 387.89 g/mol. Its IUPAC name is 4-[[5-(5-chloro-2-methoxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-1-phenylbutan-1-one.
| Compound Name | 4-[[5-(5-chloro-2-methoxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-1-phenylbutan-1-one |
|---|---|
| PubChem CID | 16543370 |
| Molecular Formula | C19H18ClN3O2S |
| Molecular Weight | 387.89 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 4-[[5-(5-chloro-2-methoxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-1-phenylbutan-1-one |
| SMILES | COc1ccc(Cl)cc1-c1nc(SCCCC(=O)c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C19H18ClN3O2S/c1-25-17-10-9-14(20)12-15(17)18-21-19(23-22-18)26-11-5-8-16(24)13-6-3-2-4-7-13/h2-4,6-7,9-10,12H,5,8,11H2,1H3,(H,21,22,23) |
| InChIKey | IAHPLWDMHPTDKN-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.89 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|