C17H16ClN3O2S2 — CID 7982201
4-[[5-(5-chloro-2-methoxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-1-thiophen-2-ylbutan-1-one (PubChem CID 7982201) has the molecular formula C17H16ClN3O2S2 and a molecular weight of 393.92 g/mol. Its IUPAC name is 4-[[5-(5-chloro-2-methoxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-1-thiophen-2-ylbutan-1-one.
| Compound Name | 4-[[5-(5-chloro-2-methoxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-1-thiophen-2-ylbutan-1-one |
|---|---|
| PubChem CID | 7982201 |
| Molecular Formula | C17H16ClN3O2S2 |
| Molecular Weight | 393.92 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | 4-[[5-(5-chloro-2-methoxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-1-thiophen-2-ylbutan-1-one |
| SMILES | COc1ccc(Cl)cc1-c1nc(SCCCC(=O)c2cccs2)n[nH]1 |
| InChI | InChI=1S/C17H16ClN3O2S2/c1-23-14-7-6-11(18)10-12(14)16-19-17(21-20-16)25-9-2-4-13(22)15-5-3-8-24-15/h3,5-8,10H,2,4,9H2,1H3,(H,19,20,21) |
| InChIKey | XWXDMZQAYYOQKD-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.92 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|