C14H10F2N4 — CID 82569258
3-[3-(3,5-difluorophenyl)-1H-1,2,4-triazol-5-yl]aniline (PubChem CID 82569258) has the molecular formula C14H10F2N4 and a molecular weight of 272.26 g/mol. Its IUPAC name is 3-[3-(3,5-difluorophenyl)-1H-1,2,4-triazol-5-yl]aniline.
| Compound Name | 3-[3-(3,5-difluorophenyl)-1H-1,2,4-triazol-5-yl]aniline |
|---|---|
| PubChem CID | 82569258 |
| Molecular Formula | C14H10F2N4 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 3-[3-(3,5-difluorophenyl)-1H-1,2,4-triazol-5-yl]aniline |
| SMILES | Nc1cccc(-c2nc(-c3cc(F)cc(F)c3)n[nH]2)c1 |
| InChI | InChI=1S/C14H10F2N4/c15-10-4-9(5-11(16)7-10)14-18-13(19-20-14)8-2-1-3-12(17)6-8/h1-7H,17H2,(H,18,19,20) |
| InChIKey | MUPXYNVZPFDWLR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|