C14H11N5O2 — CID 82569233
3-[5-(4-nitrophenyl)-1H-1,2,4-triazol-3-yl]aniline (PubChem CID 82569233) has the molecular formula C14H11N5O2 and a molecular weight of 281.28 g/mol. Its IUPAC name is 3-[5-(4-nitrophenyl)-1H-1,2,4-triazol-3-yl]aniline.
| Compound Name | 3-[5-(4-nitrophenyl)-1H-1,2,4-triazol-3-yl]aniline |
|---|---|
| PubChem CID | 82569233 |
| Molecular Formula | C14H11N5O2 |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 3-[5-(4-nitrophenyl)-1H-1,2,4-triazol-3-yl]aniline |
| SMILES | Nc1cccc(-c2n[nH]c(-c3ccc([N+](=O)[O-])cc3)n2)c1 |
| InChI | InChI=1S/C14H11N5O2/c15-11-3-1-2-10(8-11)14-16-13(17-18-14)9-4-6-12(7-5-9)19(20)21/h1-8H,15H2,(H,16,17,18) |
| InChIKey | LEKCBVSGHVQOJO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 110.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|