C14H9N5O4 — CID 3089181
3-(3,5-dinitrophenyl)-5-phenyl-1H-1,2,4-triazole (PubChem CID 3089181) has the molecular formula C14H9N5O4 and a molecular weight of 311.26 g/mol. Its IUPAC name is 3-(3,5-dinitrophenyl)-5-phenyl-1H-1,2,4-triazole.
| Compound Name | 3-(3,5-dinitrophenyl)-5-phenyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 3089181 |
| Molecular Formula | C14H9N5O4 |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 3-(3,5-dinitrophenyl)-5-phenyl-1H-1,2,4-triazole |
| SMILES | O=[N+]([O-])c1cc(-c2n[nH]c(-c3ccccc3)n2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H9N5O4/c20-18(21)11-6-10(7-12(8-11)19(22)23)14-15-13(16-17-14)9-4-2-1-3-5-9/h1-8H,(H,15,16,17) |
| InChIKey | RSVSVTFVNBBUOK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 127.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|