C18H15N7O2 — CID 126610122
3-(3-nitro-5-phenylphenyl)-5-[2-(1H-1,2,4-triazol-5-yl)ethyl]-1H-1,2,4-triazole (PubChem CID 126610122) has the molecular formula C18H15N7O2 and a molecular weight of 361.37 g/mol. Its IUPAC name is 3-(3-nitro-5-phenylphenyl)-5-[2-(1H-1,2,4-triazol-5-yl)ethyl]-1H-1,2,4-triazole.
| Compound Name | 3-(3-nitro-5-phenylphenyl)-5-[2-(1H-1,2,4-triazol-5-yl)ethyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 126610122 |
| Molecular Formula | C18H15N7O2 |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 3-(3-nitro-5-phenylphenyl)-5-[2-(1H-1,2,4-triazol-5-yl)ethyl]-1H-1,2,4-triazole |
| SMILES | O=[N+]([O-])c1cc(-c2ccccc2)cc(-c2n[nH]c(CCc3ncn[nH]3)n2)c1 |
| InChI | InChI=1S/C18H15N7O2/c26-25(27)15-9-13(12-4-2-1-3-5-12)8-14(10-15)18-21-17(23-24-18)7-6-16-19-11-20-22-16/h1-5,8-11H,6-7H2,(H,19,20,22)(H,21,23,24) |
| InChIKey | JOOKPJUPXGPCOM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 126.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|