C13H17N5O2 — CID 82569318
5-[3-(3-nitrophenyl)-1H-1,2,4-triazol-5-yl]pentan-1-amine (PubChem CID 82569318) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is 5-[3-(3-nitrophenyl)-1H-1,2,4-triazol-5-yl]pentan-1-amine.
| Compound Name | 5-[3-(3-nitrophenyl)-1H-1,2,4-triazol-5-yl]pentan-1-amine |
|---|---|
| PubChem CID | 82569318 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 5-[3-(3-nitrophenyl)-1H-1,2,4-triazol-5-yl]pentan-1-amine |
| SMILES | NCCCCCc1nc(-c2cccc([N+](=O)[O-])c2)n[nH]1 |
| InChI | InChI=1S/C13H17N5O2/c14-8-3-1-2-7-12-15-13(17-16-12)10-5-4-6-11(9-10)18(19)20/h4-6,9H,1-3,7-8,14H2,(H,15,16,17) |
| InChIKey | OREYRAURRRYEAJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 110.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|