C18H24N6O4 — CID 54773227
tert-butyl 4-[[3-(3-nitrophenyl)-1H-1,2,4-triazol-5-yl]methyl]piperazine-1-carboxylate (PubChem CID 54773227) has the molecular formula C18H24N6O4 and a molecular weight of 388.43 g/mol. Its IUPAC name is tert-butyl 4-[[3-(3-nitrophenyl)-1H-1,2,4-triazol-5-yl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[3-(3-nitrophenyl)-1H-1,2,4-triazol-5-yl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 54773227 |
| Molecular Formula | C18H24N6O4 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | tert-butyl 4-[[3-(3-nitrophenyl)-1H-1,2,4-triazol-5-yl]methyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2nc(-c3cccc([N+](=O)[O-])c3)n[nH]2)CC1 |
| InChI | InChI=1S/C18H24N6O4/c1-18(2,3)28-17(25)23-9-7-22(8-10-23)12-15-19-16(21-20-15)13-5-4-6-14(11-13)24(26)27/h4-6,11H,7-10,12H2,1-3H3,(H,19,20,21) |
| InChIKey | CGCHCCXBFKXGPX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 117.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|