C14H9ClN4O2 — CID 43831647
3-(3-chlorophenyl)-5-(2-nitrophenyl)-1H-1,2,4-triazole (PubChem CID 43831647) has the molecular formula C14H9ClN4O2 and a molecular weight of 300.71 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-5-(2-nitrophenyl)-1H-1,2,4-triazole.
| Compound Name | 3-(3-chlorophenyl)-5-(2-nitrophenyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 43831647 |
| Molecular Formula | C14H9ClN4O2 |
| Molecular Weight | 300.71 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 3-(3-chlorophenyl)-5-(2-nitrophenyl)-1H-1,2,4-triazole |
| SMILES | O=[N+]([O-])c1ccccc1-c1nc(-c2cccc(Cl)c2)n[nH]1 |
| InChI | InChI=1S/C14H9ClN4O2/c15-10-5-3-4-9(8-10)13-16-14(18-17-13)11-6-1-2-7-12(11)19(20)21/h1-8H,(H,16,17,18) |
| InChIKey | CNXSZIZVKRLDNI-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.71 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|