C9H6N4O3 — CID 70248032
3-(4-nitrophenyl)-1H-1,2,4-triazin-6-one (PubChem CID 70248032) has the molecular formula C9H6N4O3 and a molecular weight of 218.17 g/mol. Its IUPAC name is 3-(4-nitrophenyl)-1H-1,2,4-triazin-6-one.
| Compound Name | 3-(4-nitrophenyl)-1H-1,2,4-triazin-6-one |
|---|---|
| PubChem CID | 70248032 |
| Molecular Formula | C9H6N4O3 |
| Molecular Weight | 218.17 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | 3-(4-nitrophenyl)-1H-1,2,4-triazin-6-one |
| SMILES | O=c1cnc(-c2ccc([N+](=O)[O-])cc2)n[nH]1 |
| InChI | InChI=1S/C9H6N4O3/c14-8-5-10-9(12-11-8)6-1-3-7(4-2-6)13(15)16/h1-5H,(H,11,14) |
| InChIKey | IWSOOHSZJLKNNK-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.17 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|