C15H12F2N4 — CID 82568482
3-[5-[(2,4-difluorophenyl)methyl]-1H-1,2,4-triazol-3-yl]aniline (PubChem CID 82568482) has the molecular formula C15H12F2N4 and a molecular weight of 286.29 g/mol. Its IUPAC name is 3-[5-[(2,4-difluorophenyl)methyl]-1H-1,2,4-triazol-3-yl]aniline.
| Compound Name | 3-[5-[(2,4-difluorophenyl)methyl]-1H-1,2,4-triazol-3-yl]aniline |
|---|---|
| PubChem CID | 82568482 |
| Molecular Formula | C15H12F2N4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 3-[5-[(2,4-difluorophenyl)methyl]-1H-1,2,4-triazol-3-yl]aniline |
| SMILES | Nc1cccc(-c2n[nH]c(Cc3ccc(F)cc3F)n2)c1 |
| InChI | InChI=1S/C15H12F2N4/c16-11-5-4-9(13(17)8-11)7-14-19-15(21-20-14)10-2-1-3-12(18)6-10/h1-6,8H,7,18H2,(H,19,20,21) |
| InChIKey | JUUMZWVDPQMCRL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|