C18H10N8 — CID 168609110
2-[4-(3-pyridin-3-yl-1H-1,2,4-triazol-5-yl)anilino]ethene-1,1,2-tricarbonitrile (PubChem CID 168609110) has the molecular formula C18H10N8 and a molecular weight of 338.33 g/mol. Its IUPAC name is 2-[4-(3-pyridin-3-yl-1H-1,2,4-triazol-5-yl)anilino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[4-(3-pyridin-3-yl-1H-1,2,4-triazol-5-yl)anilino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168609110 |
| Molecular Formula | C18H10N8 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 2-[4-(3-pyridin-3-yl-1H-1,2,4-triazol-5-yl)anilino]ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)Nc1ccc(-c2nc(-c3cccnc3)n[nH]2)cc1 |
| InChI | InChI=1S/C18H10N8/c19-8-14(9-20)16(10-21)23-15-5-3-12(4-6-15)17-24-18(26-25-17)13-2-1-7-22-11-13/h1-7,11,23H,(H,24,25,26) |
| InChIKey | OXJZWKQPSVGKOO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 137.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|