C17H20N2O3 — CID 21137771
N,N-dimethyl-2-nitro-5-(3,4,5-trimethylphenoxy)aniline (PubChem CID 21137771) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is N,N-dimethyl-2-nitro-5-(3,4,5-trimethylphenoxy)aniline.
| Compound Name | N,N-dimethyl-2-nitro-5-(3,4,5-trimethylphenoxy)aniline |
|---|---|
| PubChem CID | 21137771 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | N,N-dimethyl-2-nitro-5-(3,4,5-trimethylphenoxy)aniline |
| SMILES | Cc1cc(Oc2ccc([N+](=O)[O-])c(N(C)C)c2)cc(C)c1C |
| InChI | InChI=1S/C17H20N2O3/c1-11-8-15(9-12(2)13(11)3)22-14-6-7-16(19(20)21)17(10-14)18(4)5/h6-10H,1-5H3 |
| InChIKey | OITJHKSDRIZZBT-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|