[5-(3,4-dimethylphenoxy)-2-nitrophenyl]-methylcarbamic acid

C16H16N2O5 — CID 68662317

IUPAC[5-(3,4-dimethylphenoxy)-2-nitrophenyl]-methylcarbamic acid
SMILESCc1ccc(Oc2ccc([N+](=O)[O-])c(N(C)C(=O)O)c2)cc1C
InChIInChI=1S/C16H16N2O5/c1-10-4-5-12(8-11(10)2)23-13-6-7-14(18(21)22)15(9-13)17(3)16(19)20/h4-9H,1-3H3,(H,19,20)
InChIKeyCKMUPEPWMYHSBI-UHFFFAOYSA-N
MW316.31 g/mol
LogP4.12
Rot. Bonds4

About [5-(3,4-dimethylphenoxy)-2-nitrophenyl]-methylcarbamic acid

[5-(3,4-dimethylphenoxy)-2-nitrophenyl]-methylcarbamic acid (PubChem CID 68662317) has the molecular formula C16H16N2O5 and a molecular weight of 316.31 g/mol. Its IUPAC name is [5-(3,4-dimethylphenoxy)-2-nitrophenyl]-methylcarbamic acid.

Molecular Properties

Compound Name[5-(3,4-dimethylphenoxy)-2-nitrophenyl]-methylcarbamic acid
PubChem CID68662317
Molecular FormulaC16H16N2O5
Molecular Weight316.31 g/mol
Exact Mass316.11
IUPAC Name[5-(3,4-dimethylphenoxy)-2-nitrophenyl]-methylcarbamic acid
SMILESCc1ccc(Oc2ccc([N+](=O)[O-])c(N(C)C(=O)O)c2)cc1C
InChIInChI=1S/C16H16N2O5/c1-10-4-5-12(8-11(10)2)23-13-6-7-14(18(21)22)15(9-13)17(3)16(19)20/h4-9H,1-3H3,(H,19,20)
InChIKeyCKMUPEPWMYHSBI-UHFFFAOYSA-N
XLogP4.12
TPSA92.91 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500316.31
LogP ≤ 54.12
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze [5-(3,4-dimethylphenoxy)-2-nitrophenyl]-methylcarbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [5-(3,4-dimethylphenoxy)-2-nitrophenyl]-methylcarbamic acid?
The IUPAC name of [5-(3,4-dimethylphenoxy)-2-nitrophenyl]-methylcarbamic acid (CID 68662317) is [5-(3,4-dimethylphenoxy)-2-nitrophenyl]-methylcarbamic acid.
What is the SMILES notation for [5-(3,4-dimethylphenoxy)-2-nitrophenyl]-methylcarbamic acid?
The canonical SMILES for [5-(3,4-dimethylphenoxy)-2-nitrophenyl]-methylcarbamic acid is Cc1ccc(Oc2ccc([N+](=O)[O-])c(N(C)C(=O)O)c2)cc1C.
What is the InChIKey of [5-(3,4-dimethylphenoxy)-2-nitrophenyl]-methylcarbamic acid?
The InChIKey is CKMUPEPWMYHSBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O5/c1-10-4-5-12(8-11(10)2)23-13-6-7-14(18(21)22)15(9-13)17(3)16(19)20/h4-9H,1-3H3,(H,19,20).
What are the key properties of [5-(3,4-dimethylphenoxy)-2-nitrophenyl]-methylcarbamic acid?
[5-(3,4-dimethylphenoxy)-2-nitrophenyl]-methylcarbamic acid has a molecular weight of 316.31 g/mol, XLogP of 4.12, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(3,4-dimethylphenoxy)-2-nitrophenyl]-methylcarbamic acid is sourced from PubChem (CID 68662317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).