C13H10ClF3N4O5 — CID 22159841
[5-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]oxy-2-nitrophenyl]-methylcarbamic acid (PubChem CID 22159841) has the molecular formula C13H10ClF3N4O5 and a molecular weight of 394.69 g/mol. Its IUPAC name is [5-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]oxy-2-nitrophenyl]-methylcarbamic acid.
| Compound Name | [5-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]oxy-2-nitrophenyl]-methylcarbamic acid |
|---|---|
| PubChem CID | 22159841 |
| Molecular Formula | C13H10ClF3N4O5 |
| Molecular Weight | 394.69 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | [5-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]oxy-2-nitrophenyl]-methylcarbamic acid |
| SMILES | CN(C(=O)O)c1cc(Oc2nn(C)c(C(F)(F)F)c2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H10ClF3N4O5/c1-19(12(22)23)8-5-6(3-4-7(8)21(24)25)26-11-9(14)10(13(15,16)17)20(2)18-11/h3-5H,1-2H3,(H,22,23) |
| InChIKey | GXENKHAEOUOACK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 110.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.69 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|