C19H21ClF3N3O6 — CID 70375033
2-[5-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]oxy-2-nitrophenoxy]-2-methylheptanoic acid (PubChem CID 70375033) has the molecular formula C19H21ClF3N3O6 and a molecular weight of 479.84 g/mol. Its IUPAC name is 2-[5-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]oxy-2-nitrophenoxy]-2-methylheptanoic acid.
| Compound Name | 2-[5-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]oxy-2-nitrophenoxy]-2-methylheptanoic acid |
|---|---|
| PubChem CID | 70375033 |
| Molecular Formula | C19H21ClF3N3O6 |
| Molecular Weight | 479.84 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | 2-[5-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]oxy-2-nitrophenoxy]-2-methylheptanoic acid |
| SMILES | CCCCCC(C)(Oc1cc(Oc2nn(C)c(C(F)(F)F)c2Cl)ccc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C19H21ClF3N3O6/c1-4-5-6-9-18(2,17(27)28)32-13-10-11(7-8-12(13)26(29)30)31-16-14(20)15(19(21,22)23)25(3)24-16/h7-8,10H,4-6,9H2,1-3H3,(H,27,28) |
| InChIKey | RYORVQGUFGPTDQ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.84 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|