C16H14ClF3N4O7 — CID 88616352
2-[[1-[5-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]oxy-2-nitrophenyl]-2-methoxyethylidene]amino]oxyacetic acid (PubChem CID 88616352) has the molecular formula C16H14ClF3N4O7 and a molecular weight of 466.76 g/mol. Its IUPAC name is 2-[[1-[5-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]oxy-2-nitrophenyl]-2-methoxyethylidene]amino]oxyacetic acid.
| Compound Name | 2-[[1-[5-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]oxy-2-nitrophenyl]-2-methoxyethylidene]amino]oxyacetic acid |
|---|---|
| PubChem CID | 88616352 |
| Molecular Formula | C16H14ClF3N4O7 |
| Molecular Weight | 466.76 g/mol |
| Exact Mass | 466.05 |
| IUPAC Name | 2-[[1-[5-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]oxy-2-nitrophenyl]-2-methoxyethylidene]amino]oxyacetic acid |
| SMILES | COCC(=NOCC(=O)O)c1cc(Oc2nn(C)c(C(F)(F)F)c2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H14ClF3N4O7/c1-23-14(16(18,19)20)13(17)15(21-23)31-8-3-4-11(24(27)28)9(5-8)10(6-29-2)22-30-7-12(25)26/h3-5H,6-7H2,1-2H3,(H,25,26) |
| InChIKey | BFNARDLJTRNHBT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 138.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.76 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|