C16H9ClF3NO7 — CID 90849693
2-[5-(2-chloro-3,5,6-trifluoro-4-methylphenoxy)-2-nitrobenzoyl]oxyacetic acid (PubChem CID 90849693) has the molecular formula C16H9ClF3NO7 and a molecular weight of 419.70 g/mol. Its IUPAC name is 2-[5-(2-chloro-3,5,6-trifluoro-4-methylphenoxy)-2-nitrobenzoyl]oxyacetic acid.
| Compound Name | 2-[5-(2-chloro-3,5,6-trifluoro-4-methylphenoxy)-2-nitrobenzoyl]oxyacetic acid |
|---|---|
| PubChem CID | 90849693 |
| Molecular Formula | C16H9ClF3NO7 |
| Molecular Weight | 419.70 g/mol |
| Exact Mass | 419.00 |
| IUPAC Name | 2-[5-(2-chloro-3,5,6-trifluoro-4-methylphenoxy)-2-nitrobenzoyl]oxyacetic acid |
| SMILES | Cc1c(F)c(F)c(Oc2ccc([N+](=O)[O-])c(C(=O)OCC(=O)O)c2)c(Cl)c1F |
| InChI | InChI=1S/C16H9ClF3NO7/c1-6-12(18)11(17)15(14(20)13(6)19)28-7-2-3-9(21(25)26)8(4-7)16(24)27-5-10(22)23/h2-4H,5H2,1H3,(H,22,23) |
| InChIKey | KLUDKXDYEBJJOC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.70 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|