C14H6Cl2F3NO4 — CID 88738654
5-(2-chloro-3,5,6-trifluoro-4-methylphenoxy)-2-nitrobenzoyl chloride (PubChem CID 88738654) has the molecular formula C14H6Cl2F3NO4 and a molecular weight of 380.11 g/mol. Its IUPAC name is 5-(2-chloro-3,5,6-trifluoro-4-methylphenoxy)-2-nitrobenzoyl chloride.
| Compound Name | 5-(2-chloro-3,5,6-trifluoro-4-methylphenoxy)-2-nitrobenzoyl chloride |
|---|---|
| PubChem CID | 88738654 |
| Molecular Formula | C14H6Cl2F3NO4 |
| Molecular Weight | 380.11 g/mol |
| Exact Mass | 378.96 |
| IUPAC Name | 5-(2-chloro-3,5,6-trifluoro-4-methylphenoxy)-2-nitrobenzoyl chloride |
| SMILES | Cc1c(F)c(F)c(Oc2ccc([N+](=O)[O-])c(C(=O)Cl)c2)c(Cl)c1F |
| InChI | InChI=1S/C14H6Cl2F3NO4/c1-5-10(17)9(15)13(12(19)11(5)18)24-6-2-3-8(20(22)23)7(4-6)14(16)21/h2-4H,1H3 |
| InChIKey | SKLCZGAZDKNCHH-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.11 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|