C16H12ClF3O5S — CID 88743486
methyl 5-(2-chloro-3,5,6-trifluoro-4-methylphenoxy)-2-methylsulfonylbenzoate (PubChem CID 88743486) has the molecular formula C16H12ClF3O5S and a molecular weight of 408.78 g/mol. Its IUPAC name is methyl 5-(2-chloro-3,5,6-trifluoro-4-methylphenoxy)-2-methylsulfonylbenzoate.
| Compound Name | methyl 5-(2-chloro-3,5,6-trifluoro-4-methylphenoxy)-2-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 88743486 |
| Molecular Formula | C16H12ClF3O5S |
| Molecular Weight | 408.78 g/mol |
| Exact Mass | 408.00 |
| IUPAC Name | methyl 5-(2-chloro-3,5,6-trifluoro-4-methylphenoxy)-2-methylsulfonylbenzoate |
| SMILES | COC(=O)c1cc(Oc2c(F)c(F)c(C)c(F)c2Cl)ccc1S(C)(=O)=O |
| InChI | InChI=1S/C16H12ClF3O5S/c1-7-12(18)11(17)15(14(20)13(7)19)25-8-4-5-10(26(3,22)23)9(6-8)16(21)24-2/h4-6H,1-3H3 |
| InChIKey | NWOSPHBZGHJIDA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.78 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|