C16H8F7NO5 — CID 21287085
ethyl 2-nitro-5-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenoxy]benzoate (PubChem CID 21287085) has the molecular formula C16H8F7NO5 and a molecular weight of 427.23 g/mol. Its IUPAC name is ethyl 2-nitro-5-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenoxy]benzoate.
| Compound Name | ethyl 2-nitro-5-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenoxy]benzoate |
|---|---|
| PubChem CID | 21287085 |
| Molecular Formula | C16H8F7NO5 |
| Molecular Weight | 427.23 g/mol |
| Exact Mass | 427.03 |
| IUPAC Name | ethyl 2-nitro-5-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenoxy]benzoate |
| SMILES | CCOC(=O)c1cc(Oc2c(F)c(F)c(C(F)(F)F)c(F)c2F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H8F7NO5/c1-2-28-15(25)7-5-6(3-4-8(7)24(26)27)29-14-12(19)10(17)9(16(21,22)23)11(18)13(14)20/h3-5H,2H2,1H3 |
| InChIKey | CUQMOVSFUBLDSH-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.23 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|