C18H14Cl3NO8 — CID 70557118
[2-(2-methoxyethoxy)-2-oxoethyl] 2-nitro-5-(2,4,6-trichlorophenoxy)benzoate (PubChem CID 70557118) has the molecular formula C18H14Cl3NO8 and a molecular weight of 478.67 g/mol. Its IUPAC name is [2-(2-methoxyethoxy)-2-oxoethyl] 2-nitro-5-(2,4,6-trichlorophenoxy)benzoate.
| Compound Name | [2-(2-methoxyethoxy)-2-oxoethyl] 2-nitro-5-(2,4,6-trichlorophenoxy)benzoate |
|---|---|
| PubChem CID | 70557118 |
| Molecular Formula | C18H14Cl3NO8 |
| Molecular Weight | 478.67 g/mol |
| Exact Mass | 476.98 |
| IUPAC Name | [2-(2-methoxyethoxy)-2-oxoethyl] 2-nitro-5-(2,4,6-trichlorophenoxy)benzoate |
| SMILES | COCCOC(=O)COC(=O)c1cc(Oc2c(Cl)cc(Cl)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H14Cl3NO8/c1-27-4-5-28-16(23)9-29-18(24)12-8-11(2-3-15(12)22(25)26)30-17-13(20)6-10(19)7-14(17)21/h2-3,6-8H,4-5,9H2,1H3 |
| InChIKey | FCGIJHDADHCZJI-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.67 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|