C13H11ClF3N3O4 — CID 152641447
4-chloro-3-(2,4-dimethoxy-5-nitrophenyl)-1-methyl-5-(trifluoromethyl)pyrazole (PubChem CID 152641447) has the molecular formula C13H11ClF3N3O4 and a molecular weight of 365.70 g/mol. Its IUPAC name is 4-chloro-3-(2,4-dimethoxy-5-nitrophenyl)-1-methyl-5-(trifluoromethyl)pyrazole.
| Compound Name | 4-chloro-3-(2,4-dimethoxy-5-nitrophenyl)-1-methyl-5-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 152641447 |
| Molecular Formula | C13H11ClF3N3O4 |
| Molecular Weight | 365.70 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | 4-chloro-3-(2,4-dimethoxy-5-nitrophenyl)-1-methyl-5-(trifluoromethyl)pyrazole |
| SMILES | COc1cc(OC)c([N+](=O)[O-])cc1-c1nn(C)c(C(F)(F)F)c1Cl |
| InChI | InChI=1S/C13H11ClF3N3O4/c1-19-12(13(15,16)17)10(14)11(18-19)6-4-7(20(21)22)9(24-3)5-8(6)23-2/h4-5H,1-3H3 |
| InChIKey | ZFQPWIWHHFXZOM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 79.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.70 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|