C15H12ClF4N3O7S — CID 174410582
2-[2-[5-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-4-fluoro-2-nitrophenyl]acetyl]oxyethanesulfonic acid (PubChem CID 174410582) has the molecular formula C15H12ClF4N3O7S and a molecular weight of 489.79 g/mol. Its IUPAC name is 2-[2-[5-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-4-fluoro-2-nitrophenyl]acetyl]oxyethanesulfonic acid.
| Compound Name | 2-[2-[5-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-4-fluoro-2-nitrophenyl]acetyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 174410582 |
| Molecular Formula | C15H12ClF4N3O7S |
| Molecular Weight | 489.79 g/mol |
| Exact Mass | 489.00 |
| IUPAC Name | 2-[2-[5-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-4-fluoro-2-nitrophenyl]acetyl]oxyethanesulfonic acid |
| SMILES | Cn1nc(-c2cc(CC(=O)OCCS(=O)(=O)O)c([N+](=O)[O-])cc2F)c(Cl)c1C(F)(F)F |
| InChI | InChI=1S/C15H12ClF4N3O7S/c1-22-14(15(18,19)20)12(16)13(21-22)8-4-7(10(23(25)26)6-9(8)17)5-11(24)30-2-3-31(27,28)29/h4,6H,2-3,5H2,1H3,(H,27,28,29) |
| InChIKey | QXQJBCAFQRBLNT-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 141.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.79 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|