C21H16Cl2F3N3O6 — CID 70533697
2-imidazol-1-ylethyl 2-[5-[2,6-dichloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]propanoate (PubChem CID 70533697) has the molecular formula C21H16Cl2F3N3O6 and a molecular weight of 534.27 g/mol. Its IUPAC name is 2-imidazol-1-ylethyl 2-[5-[2,6-dichloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]propanoate.
| Compound Name | 2-imidazol-1-ylethyl 2-[5-[2,6-dichloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]propanoate |
|---|---|
| PubChem CID | 70533697 |
| Molecular Formula | C21H16Cl2F3N3O6 |
| Molecular Weight | 534.27 g/mol |
| Exact Mass | 533.04 |
| IUPAC Name | 2-imidazol-1-ylethyl 2-[5-[2,6-dichloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]propanoate |
| SMILES | CC(Oc1cc(Oc2c(Cl)cc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-])C(=O)OCCn1ccnc1 |
| InChI | InChI=1S/C21H16Cl2F3N3O6/c1-12(20(30)33-7-6-28-5-4-27-11-28)34-18-10-14(2-3-17(18)29(31)32)35-19-15(22)8-13(9-16(19)23)21(24,25)26/h2-5,8-12H,6-7H2,1H3 |
| InChIKey | BJNGSBNHVCMKCH-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 105.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.27 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|