C14H8Cl2F3N3O4 — CID 14209901
N-[6-[2,6-dichloro-4-(trifluoromethyl)phenoxy]-3-nitro-2-pyridinyl]acetamide (PubChem CID 14209901) has the molecular formula C14H8Cl2F3N3O4 and a molecular weight of 410.14 g/mol. Its IUPAC name is N-[6-[2,6-dichloro-4-(trifluoromethyl)phenoxy]-3-nitro-2-pyridinyl]acetamide.
| Compound Name | N-[6-[2,6-dichloro-4-(trifluoromethyl)phenoxy]-3-nitro-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 14209901 |
| Molecular Formula | C14H8Cl2F3N3O4 |
| Molecular Weight | 410.14 g/mol |
| Exact Mass | 408.98 |
| IUPAC Name | N-[6-[2,6-dichloro-4-(trifluoromethyl)phenoxy]-3-nitro-2-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1nc(Oc2c(Cl)cc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H8Cl2F3N3O4/c1-6(23)20-13-10(22(24)25)2-3-11(21-13)26-12-8(15)4-7(5-9(12)16)14(17,18)19/h2-5H,1H3,(H,20,21,23) |
| InChIKey | QSZLQHROPMCNQF-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.14 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|