C15H9Cl2F3N2O6 — CID 70422028
2-[6-[2,6-dichloro-4-(trifluoromethyl)phenoxy]-3-nitro-2-pyridinyl]-2-hydroxypropanoic acid (PubChem CID 70422028) has the molecular formula C15H9Cl2F3N2O6 and a molecular weight of 441.15 g/mol. Its IUPAC name is 2-[6-[2,6-dichloro-4-(trifluoromethyl)phenoxy]-3-nitro-2-pyridinyl]-2-hydroxypropanoic acid.
| Compound Name | 2-[6-[2,6-dichloro-4-(trifluoromethyl)phenoxy]-3-nitro-2-pyridinyl]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 70422028 |
| Molecular Formula | C15H9Cl2F3N2O6 |
| Molecular Weight | 441.15 g/mol |
| Exact Mass | 439.98 |
| IUPAC Name | 2-[6-[2,6-dichloro-4-(trifluoromethyl)phenoxy]-3-nitro-2-pyridinyl]-2-hydroxypropanoic acid |
| SMILES | CC(O)(C(=O)O)c1nc(Oc2c(Cl)cc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H9Cl2F3N2O6/c1-14(25,13(23)24)12-9(22(26)27)2-3-10(21-12)28-11-7(16)4-6(5-8(11)17)15(18,19)20/h2-5,25H,1H3,(H,23,24) |
| InChIKey | ZXARQFGQHAKBTN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 122.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.15 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|