C20H18Cl2F3NO9 — CID 158908895
2-[3-[2,6-dichloro-4-(trifluoromethyl)phenoxy]phenoxy]-2-nitropropanoic acid;ethyl 2-hydroxyacetate (PubChem CID 158908895) has the molecular formula C20H18Cl2F3NO9 and a molecular weight of 544.26 g/mol. Its IUPAC name is 2-[3-[2,6-dichloro-4-(trifluoromethyl)phenoxy]phenoxy]-2-nitropropanoic acid;ethyl 2-hydroxyacetate.
| Compound Name | 2-[3-[2,6-dichloro-4-(trifluoromethyl)phenoxy]phenoxy]-2-nitropropanoic acid;ethyl 2-hydroxyacetate |
|---|---|
| PubChem CID | 158908895 |
| Molecular Formula | C20H18Cl2F3NO9 |
| Molecular Weight | 544.26 g/mol |
| Exact Mass | 543.03 |
| IUPAC Name | 2-[3-[2,6-dichloro-4-(trifluoromethyl)phenoxy]phenoxy]-2-nitropropanoic acid;ethyl 2-hydroxyacetate |
| SMILES | CC(Oc1cccc(Oc2c(Cl)cc(C(F)(F)F)cc2Cl)c1)(C(=O)O)[N+](=O)[O-].CCOC(=O)CO |
| InChI | InChI=1S/C16H10Cl2F3NO6.C4H8O3/c1-15(14(23)24,22(25)26)28-10-4-2-3-9(7-10)27-13-11(17)5-8(6-12(13)18)16(19,20)21;1-2-7-4(6)3-5/h2-7H,1H3,(H,23,24);5H,2-3H2,1H3 |
| InChIKey | JGJVQKZIEDUSDH-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 145.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.26 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|