C13H5Cl2F3N2O4 — CID 166584127
3-chloro-6-[2-chloro-6-nitro-4-(trifluoromethyl)phenyl]pyridine-2-carboxylic acid (PubChem CID 166584127) has the molecular formula C13H5Cl2F3N2O4 and a molecular weight of 381.09 g/mol. Its IUPAC name is 3-chloro-6-[2-chloro-6-nitro-4-(trifluoromethyl)phenyl]pyridine-2-carboxylic acid.
| Compound Name | 3-chloro-6-[2-chloro-6-nitro-4-(trifluoromethyl)phenyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 166584127 |
| Molecular Formula | C13H5Cl2F3N2O4 |
| Molecular Weight | 381.09 g/mol |
| Exact Mass | 379.96 |
| IUPAC Name | 3-chloro-6-[2-chloro-6-nitro-4-(trifluoromethyl)phenyl]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1nc(-c2c(Cl)cc(C(F)(F)F)cc2[N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C13H5Cl2F3N2O4/c14-6-1-2-8(19-11(6)12(21)22)10-7(15)3-5(13(16,17)18)4-9(10)20(23)24/h1-4H,(H,21,22) |
| InChIKey | GZBVCJIYVSOOBE-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.09 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|