About 3-chloro-6-[2-chloro-6-cyano-4-(trifluoromethyl)phenyl]pyridine-2-carboxylic acid;ethane
3-chloro-6-[2-chloro-6-cyano-4-(trifluoromethyl)phenyl]pyridine-2-carboxylic acid;ethane (PubChem CID 142574449) has the molecular formula C16H11Cl2F3N2O2
and a molecular weight of 391.18 g/mol. Its IUPAC name is 3-chloro-6-[2-chloro-6-cyano-4-(trifluoromethyl)phenyl]pyridine-2-carboxylic acid;ethane.
Molecular Properties
| Compound Name | 3-chloro-6-[2-chloro-6-cyano-4-(trifluoromethyl)phenyl]pyridine-2-carboxylic acid;ethane |
| PubChem CID | 142574449 |
| Molecular Formula | C16H11Cl2F3N2O2 |
| Molecular Weight | 391.18 g/mol |
| Exact Mass | 390.01 |
| IUPAC Name | 3-chloro-6-[2-chloro-6-cyano-4-(trifluoromethyl)phenyl]pyridine-2-carboxylic acid;ethane |
| SMILES | CC.N#Cc1cc(C(F)(F)F)cc(Cl)c1-c1ccc(Cl)c(C(=O)O)n1 |
| InChI | InChI=1S/C14H5Cl2F3N2O2.C2H6/c15-8-1-2-10(21-12(8)13(22)23)11-6(5-20)3-7(4-9(11)16)14(17,18)19;1-2/h1-4H,(H,22,23);1-2H3 |
| InChIKey | AEJRGPUQCDNUHU-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 73.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.18 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-chloro-6-[2-chloro-6-cyano-4-(trifluoromethyl)phenyl]pyridine-2-carboxylic acid;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-6-[2-chloro-6-cyano-4-(trifluoromethyl)phenyl]pyridine-2-carboxylic acid;ethane?
The IUPAC name of 3-chloro-6-[2-chloro-6-cyano-4-(trifluoromethyl)phenyl]pyridine-2-carboxylic acid;ethane (CID 142574449) is 3-chloro-6-[2-chloro-6-cyano-4-(trifluoromethyl)phenyl]pyridine-2-carboxylic acid;ethane.
What is the SMILES notation for 3-chloro-6-[2-chloro-6-cyano-4-(trifluoromethyl)phenyl]pyridine-2-carboxylic acid;ethane?
The canonical SMILES for 3-chloro-6-[2-chloro-6-cyano-4-(trifluoromethyl)phenyl]pyridine-2-carboxylic acid;ethane is CC.N#Cc1cc(C(F)(F)F)cc(Cl)c1-c1ccc(Cl)c(C(=O)O)n1.
What is the InChIKey of 3-chloro-6-[2-chloro-6-cyano-4-(trifluoromethyl)phenyl]pyridine-2-carboxylic acid;ethane?
The InChIKey is AEJRGPUQCDNUHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H5Cl2F3N2O2.C2H6/c15-8-1-2-10(21-12(8)13(22)23)11-6(5-20)3-7(4-9(11)16)14(17,18)19;1-2/h1-4H,(H,22,23);1-2H3.
What are the key properties of 3-chloro-6-[2-chloro-6-cyano-4-(trifluoromethyl)phenyl]pyridine-2-carboxylic acid;ethane?
3-chloro-6-[2-chloro-6-cyano-4-(trifluoromethyl)phenyl]pyridine-2-carboxylic acid;ethane has a molecular weight of 391.18 g/mol, XLogP of 5.67, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-6-[2-chloro-6-cyano-4-(trifluoromethyl)phenyl]pyridine-2-carboxylic acid;ethane is sourced from PubChem (CID 142574449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).