C11H7F3N4O5 — CID 19775930
3-(3,4-dinitrophenoxy)-1-methyl-5-(trifluoromethyl)pyrazole (PubChem CID 19775930) has the molecular formula C11H7F3N4O5 and a molecular weight of 332.19 g/mol. Its IUPAC name is 3-(3,4-dinitrophenoxy)-1-methyl-5-(trifluoromethyl)pyrazole.
| Compound Name | 3-(3,4-dinitrophenoxy)-1-methyl-5-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 19775930 |
| Molecular Formula | C11H7F3N4O5 |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 3-(3,4-dinitrophenoxy)-1-methyl-5-(trifluoromethyl)pyrazole |
| SMILES | Cn1nc(Oc2ccc([N+](=O)[O-])c([N+](=O)[O-])c2)cc1C(F)(F)F |
| InChI | InChI=1S/C11H7F3N4O5/c1-16-9(11(12,13)14)5-10(15-16)23-6-2-3-7(17(19)20)8(4-6)18(21)22/h2-5H,1H3 |
| InChIKey | VOKITQZACGHDRG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 113.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|