C13H9F2N5O3 — CID 133426050
3-(difluoromethyl)-6-(3-methyl-4-nitrophenoxy)-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 133426050) has the molecular formula C13H9F2N5O3 and a molecular weight of 321.24 g/mol. Its IUPAC name is 3-(difluoromethyl)-6-(3-methyl-4-nitrophenoxy)-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 3-(difluoromethyl)-6-(3-methyl-4-nitrophenoxy)-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 133426050 |
| Molecular Formula | C13H9F2N5O3 |
| Molecular Weight | 321.24 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 3-(difluoromethyl)-6-(3-methyl-4-nitrophenoxy)-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | Cc1cc(Oc2ccc3nnc(C(F)F)n3n2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H9F2N5O3/c1-7-6-8(2-3-9(7)20(21)22)23-11-5-4-10-16-17-13(12(14)15)19(10)18-11/h2-6,12H,1H3 |
| InChIKey | YPHZZGXSERCVAV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 95.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.24 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|