C14H16ClF3N4O2 — CID 19775925
2-[2-amino-5-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]oxyanilino]propan-1-ol (PubChem CID 19775925) has the molecular formula C14H16ClF3N4O2 and a molecular weight of 364.76 g/mol. Its IUPAC name is 2-[2-amino-5-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]oxyanilino]propan-1-ol.
| Compound Name | 2-[2-amino-5-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]oxyanilino]propan-1-ol |
|---|---|
| PubChem CID | 19775925 |
| Molecular Formula | C14H16ClF3N4O2 |
| Molecular Weight | 364.76 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | 2-[2-amino-5-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]oxyanilino]propan-1-ol |
| SMILES | CC(CO)Nc1cc(Oc2nn(C)c(C(F)(F)F)c2Cl)ccc1N |
| InChI | InChI=1S/C14H16ClF3N4O2/c1-7(6-23)20-10-5-8(3-4-9(10)19)24-13-11(15)12(14(16,17)18)22(2)21-13/h3-5,7,20,23H,6,19H2,1-2H3 |
| InChIKey | LAJOYYIIPYLMLJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.76 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|