C13H13ClF3N5O3 — CID 15017292
2-[5-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]oxy-2-nitrophenyl]-1,1-dimethylhydrazine (PubChem CID 15017292) has the molecular formula C13H13ClF3N5O3 and a molecular weight of 379.73 g/mol. Its IUPAC name is 2-[5-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]oxy-2-nitrophenyl]-1,1-dimethylhydrazine.
| Compound Name | 2-[5-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]oxy-2-nitrophenyl]-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 15017292 |
| Molecular Formula | C13H13ClF3N5O3 |
| Molecular Weight | 379.73 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | 2-[5-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]oxy-2-nitrophenyl]-1,1-dimethylhydrazine |
| SMILES | CN(C)Nc1cc(Oc2nn(C)c(C(F)(F)F)c2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H13ClF3N5O3/c1-20(2)18-8-6-7(4-5-9(8)22(23)24)25-12-10(14)11(13(15,16)17)21(3)19-12/h4-6,18H,1-3H3 |
| InChIKey | GQDVGSZUFOLJBN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.73 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|