C11H6ClF3N4O5 — CID 19775926
4-chloro-3-(3,4-dinitrophenoxy)-1-methyl-5-(trifluoromethyl)pyrazole (PubChem CID 19775926) has the molecular formula C11H6ClF3N4O5 and a molecular weight of 366.64 g/mol. Its IUPAC name is 4-chloro-3-(3,4-dinitrophenoxy)-1-methyl-5-(trifluoromethyl)pyrazole.
| Compound Name | 4-chloro-3-(3,4-dinitrophenoxy)-1-methyl-5-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 19775926 |
| Molecular Formula | C11H6ClF3N4O5 |
| Molecular Weight | 366.64 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | 4-chloro-3-(3,4-dinitrophenoxy)-1-methyl-5-(trifluoromethyl)pyrazole |
| SMILES | Cn1nc(Oc2ccc([N+](=O)[O-])c([N+](=O)[O-])c2)c(Cl)c1C(F)(F)F |
| InChI | InChI=1S/C11H6ClF3N4O5/c1-17-9(11(13,14)15)8(12)10(16-17)24-5-2-3-6(18(20)21)7(4-5)19(22)23/h2-4H,1H3 |
| InChIKey | HZODUUIGUKIAAV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 113.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.64 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|