C17H8Cl4N2O2 — CID 133087521
2,6-bis(3,4-dichlorophenyl)-3-nitropyridine (PubChem CID 133087521) has the molecular formula C17H8Cl4N2O2 and a molecular weight of 414.08 g/mol. Its IUPAC name is 2,6-bis(3,4-dichlorophenyl)-3-nitropyridine.
| Compound Name | 2,6-bis(3,4-dichlorophenyl)-3-nitropyridine |
|---|---|
| PubChem CID | 133087521 |
| Molecular Formula | C17H8Cl4N2O2 |
| Molecular Weight | 414.08 g/mol |
| Exact Mass | 411.93 |
| IUPAC Name | 2,6-bis(3,4-dichlorophenyl)-3-nitropyridine |
| SMILES | O=[N+]([O-])c1ccc(-c2ccc(Cl)c(Cl)c2)nc1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H8Cl4N2O2/c18-11-3-1-9(7-13(11)20)15-5-6-16(23(24)25)17(22-15)10-2-4-12(19)14(21)8-10/h1-8H |
| InChIKey | WNMHRKSPBAUNSJ-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.08 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|