C19H10Cl4N2 — CID 133094362
2-[2,6-bis(3,4-dichlorophenyl)-3-pyridinyl]acetonitrile (PubChem CID 133094362) has the molecular formula C19H10Cl4N2 and a molecular weight of 408.12 g/mol. Its IUPAC name is 2-[2,6-bis(3,4-dichlorophenyl)-3-pyridinyl]acetonitrile.
| Compound Name | 2-[2,6-bis(3,4-dichlorophenyl)-3-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 133094362 |
| Molecular Formula | C19H10Cl4N2 |
| Molecular Weight | 408.12 g/mol |
| Exact Mass | 405.96 |
| IUPAC Name | 2-[2,6-bis(3,4-dichlorophenyl)-3-pyridinyl]acetonitrile |
| SMILES | N#CCc1ccc(-c2ccc(Cl)c(Cl)c2)nc1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H10Cl4N2/c20-14-4-1-12(9-16(14)22)18-6-3-11(7-8-24)19(25-18)13-2-5-15(21)17(23)10-13/h1-6,9-10H,7H2 |
| InChIKey | HNEYEBSMAOMQTE-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.12 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |