C17H2F10N2O2 — CID 133087465
3-nitro-2,6-bis(2,3,4,5,6-pentafluorophenyl)pyridine (PubChem CID 133087465) has the molecular formula C17H2F10N2O2 and a molecular weight of 456.20 g/mol. Its IUPAC name is 3-nitro-2,6-bis(2,3,4,5,6-pentafluorophenyl)pyridine.
| Compound Name | 3-nitro-2,6-bis(2,3,4,5,6-pentafluorophenyl)pyridine |
|---|---|
| PubChem CID | 133087465 |
| Molecular Formula | C17H2F10N2O2 |
| Molecular Weight | 456.20 g/mol |
| Exact Mass | 456.00 |
| IUPAC Name | 3-nitro-2,6-bis(2,3,4,5,6-pentafluorophenyl)pyridine |
| SMILES | O=[N+]([O-])c1ccc(-c2c(F)c(F)c(F)c(F)c2F)nc1-c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C17H2F10N2O2/c18-7-5(8(19)12(23)15(26)11(7)22)3-1-2-4(29(30)31)17(28-3)6-9(20)13(24)16(27)14(25)10(6)21/h1-2H |
| InChIKey | GSDKTGIPHINAID-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.20 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|