C18H3F10NO2 — CID 133093784
2,6-bis(2,3,4,5,6-pentafluorophenyl)pyridine-3-carboxylic acid (PubChem CID 133093784) has the molecular formula C18H3F10NO2 and a molecular weight of 455.21 g/mol. Its IUPAC name is 2,6-bis(2,3,4,5,6-pentafluorophenyl)pyridine-3-carboxylic acid.
| Compound Name | 2,6-bis(2,3,4,5,6-pentafluorophenyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 133093784 |
| Molecular Formula | C18H3F10NO2 |
| Molecular Weight | 455.21 g/mol |
| Exact Mass | 455.00 |
| IUPAC Name | 2,6-bis(2,3,4,5,6-pentafluorophenyl)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(-c2c(F)c(F)c(F)c(F)c2F)nc1-c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H3F10NO2/c19-7-5(8(20)12(24)15(27)11(7)23)4-2-1-3(18(30)31)17(29-4)6-9(21)13(25)16(28)14(26)10(6)22/h1-2H,(H,30,31) |
| InChIKey | DHJBRAAGMFVXFV-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.21 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|