C19H10F6N2O2 — CID 134618277
3-nitro-2,6-bis[3-(trifluoromethyl)phenyl]pyridine (PubChem CID 134618277) has the molecular formula C19H10F6N2O2 and a molecular weight of 412.29 g/mol. Its IUPAC name is 3-nitro-2,6-bis[3-(trifluoromethyl)phenyl]pyridine.
| Compound Name | 3-nitro-2,6-bis[3-(trifluoromethyl)phenyl]pyridine |
|---|---|
| PubChem CID | 134618277 |
| Molecular Formula | C19H10F6N2O2 |
| Molecular Weight | 412.29 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 3-nitro-2,6-bis[3-(trifluoromethyl)phenyl]pyridine |
| SMILES | O=[N+]([O-])c1ccc(-c2cccc(C(F)(F)F)c2)nc1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H10F6N2O2/c20-18(21,22)13-5-1-3-11(9-13)15-7-8-16(27(28)29)17(26-15)12-4-2-6-14(10-12)19(23,24)25/h1-10H |
| InChIKey | IRIIROVXQZLCNW-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.29 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|