C12H12ClN5O2 — CID 103278956
N'-[4-(4-chloro-3-nitrophenyl)pyrimidin-2-yl]ethane-1,2-diamine (PubChem CID 103278956) has the molecular formula C12H12ClN5O2 and a molecular weight of 293.71 g/mol. Its IUPAC name is N'-[4-(4-chloro-3-nitrophenyl)pyrimidin-2-yl]ethane-1,2-diamine.
| Compound Name | N'-[4-(4-chloro-3-nitrophenyl)pyrimidin-2-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 103278956 |
| Molecular Formula | C12H12ClN5O2 |
| Molecular Weight | 293.71 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | N'-[4-(4-chloro-3-nitrophenyl)pyrimidin-2-yl]ethane-1,2-diamine |
| SMILES | NCCNc1nccc(-c2ccc(Cl)c([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C12H12ClN5O2/c13-9-2-1-8(7-11(9)18(19)20)10-3-5-15-12(17-10)16-6-4-14/h1-3,5,7H,4,6,14H2,(H,15,16,17) |
| InChIKey | APCZAGRFIBCFRY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.71 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|