C10H11BrN4S — CID 107355309
N'-[4-(4-bromothiophen-2-yl)pyrimidin-2-yl]ethane-1,2-diamine (PubChem CID 107355309) has the molecular formula C10H11BrN4S and a molecular weight of 299.20 g/mol. Its IUPAC name is N'-[4-(4-bromothiophen-2-yl)pyrimidin-2-yl]ethane-1,2-diamine.
| Compound Name | N'-[4-(4-bromothiophen-2-yl)pyrimidin-2-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 107355309 |
| Molecular Formula | C10H11BrN4S |
| Molecular Weight | 299.20 g/mol |
| Exact Mass | 297.99 |
| IUPAC Name | N'-[4-(4-bromothiophen-2-yl)pyrimidin-2-yl]ethane-1,2-diamine |
| SMILES | NCCNc1nccc(-c2cc(Br)cs2)n1 |
| InChI | InChI=1S/C10H11BrN4S/c11-7-5-9(16-6-7)8-1-3-13-10(15-8)14-4-2-12/h1,3,5-6H,2,4,12H2,(H,13,14,15) |
| InChIKey | WKWOREUQVYJNLW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.20 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |