C20H11Cl3N4O2 — CID 54445074
4-[2-(2-chloro-6-nitrophenyl)-4-(3,4-dichlorophenyl)-1H-imidazol-5-yl]pyridine (PubChem CID 54445074) has the molecular formula C20H11Cl3N4O2 and a molecular weight of 445.69 g/mol. Its IUPAC name is 4-[2-(2-chloro-6-nitrophenyl)-4-(3,4-dichlorophenyl)-1H-imidazol-5-yl]pyridine.
| Compound Name | 4-[2-(2-chloro-6-nitrophenyl)-4-(3,4-dichlorophenyl)-1H-imidazol-5-yl]pyridine |
|---|---|
| PubChem CID | 54445074 |
| Molecular Formula | C20H11Cl3N4O2 |
| Molecular Weight | 445.69 g/mol |
| Exact Mass | 443.99 |
| IUPAC Name | 4-[2-(2-chloro-6-nitrophenyl)-4-(3,4-dichlorophenyl)-1H-imidazol-5-yl]pyridine |
| SMILES | O=[N+]([O-])c1cccc(Cl)c1-c1nc(-c2ccc(Cl)c(Cl)c2)c(-c2ccncc2)[nH]1 |
| InChI | InChI=1S/C20H11Cl3N4O2/c21-13-5-4-12(10-15(13)23)19-18(11-6-8-24-9-7-11)25-20(26-19)17-14(22)2-1-3-16(17)27(28)29/h1-10H,(H,25,26) |
| InChIKey | WQXNHBFZZQQXIB-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.69 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|