C13H19ClN3O4- — CID 19359142
3,4-dimethyl-2,6-dinitro-N-pentan-3-ylaniline chloride (PubChem CID 19359142) has the molecular formula C13H19ClN3O4- and a molecular weight of 316.77 g/mol. Its IUPAC name is 3,4-dimethyl-2,6-dinitro-N-pentan-3-ylaniline chloride.
| Compound Name | 3,4-dimethyl-2,6-dinitro-N-pentan-3-ylaniline chloride |
|---|---|
| PubChem CID | 19359142 |
| Molecular Formula | C13H19ClN3O4- |
| Molecular Weight | 316.77 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 3,4-dimethyl-2,6-dinitro-N-pentan-3-ylaniline chloride |
| SMILES | CCC(CC)Nc1c([N+](=O)[O-])cc(C)c(C)c1[N+](=O)[O-].[Cl-] |
| InChI | InChI=1S/C13H19N3O4.ClH/c1-5-10(6-2)14-12-11(15(17)18)7-8(3)9(4)13(12)16(19)20;/h7,10,14H,5-6H2,1-4H3;1H/p-1 |
| InChIKey | NTMUBOPEFHABAI-UHFFFAOYSA-M |
| XLogP | 0.72 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.77 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|