C31H37N5O9S — CID 87494709
N-[4-(cyclopropylcarbamoyl)phenyl]sulfonyl-2-methoxybenzamide;3,4-dimethyl-2,6-dinitro-N-pentan-3-ylaniline (PubChem CID 87494709) has the molecular formula C31H37N5O9S and a molecular weight of 655.73 g/mol. Its IUPAC name is N-[4-(cyclopropylcarbamoyl)phenyl]sulfonyl-2-methoxybenzamide;3,4-dimethyl-2,6-dinitro-N-pentan-3-ylaniline.
| Compound Name | N-[4-(cyclopropylcarbamoyl)phenyl]sulfonyl-2-methoxybenzamide;3,4-dimethyl-2,6-dinitro-N-pentan-3-ylaniline |
|---|---|
| PubChem CID | 87494709 |
| Molecular Formula | C31H37N5O9S |
| Molecular Weight | 655.73 g/mol |
| Exact Mass | 655.23 |
| IUPAC Name | N-[4-(cyclopropylcarbamoyl)phenyl]sulfonyl-2-methoxybenzamide;3,4-dimethyl-2,6-dinitro-N-pentan-3-ylaniline |
| SMILES | CCC(CC)Nc1c([N+](=O)[O-])cc(C)c(C)c1[N+](=O)[O-].COc1ccccc1C(=O)NS(=O)(=O)c1ccc(C(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C18H18N2O5S.C13H19N3O4/c1-25-16-5-3-2-4-15(16)18(22)20-26(23,24)14-10-6-12(7-11-14)17(21)19-13-8-9-13;1-5-10(6-2)14-12-11(15(17)18)7-8(3)9(4)13(12)16(19)20/h2-7,10-11,13H,8-9H2,1H3,(H,19,21)(H,20,22);7,10,14H,5-6H2,1-4H3 |
| InChIKey | MPMUYUSGXOEXKS-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 199.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.73 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|