C12H17NO3 — CID 54519445
2-(2,3,4-trimethyl-6-nitrophenyl)propan-1-ol (PubChem CID 54519445) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 2-(2,3,4-trimethyl-6-nitrophenyl)propan-1-ol.
| Compound Name | 2-(2,3,4-trimethyl-6-nitrophenyl)propan-1-ol |
|---|---|
| PubChem CID | 54519445 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 2-(2,3,4-trimethyl-6-nitrophenyl)propan-1-ol |
| SMILES | Cc1cc([N+](=O)[O-])c(C(C)CO)c(C)c1C |
| InChI | InChI=1S/C12H17NO3/c1-7-5-11(13(15)16)12(8(2)6-14)10(4)9(7)3/h5,8,14H,6H2,1-4H3 |
| InChIKey | YOSWOYGADMHJCR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|